Products 1356199-69-3
CAS 1356199-69-3 appears in our catalog under these names: Metalaxyl-13C6, METALAXYL-(RING-13C6), 99 ATOM % 13C, 9&, Metalaxyl-13C6, 98.4%. Offered by: TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25mg, 2MG, 5MG, 1 mg, 5 mg.
Methyl 2-[(2,6-dimethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-(2-methoxyacetyl)amino]propanoate (CAS 1356199-69-3) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 285.29 g/mol. IUPAC name: methyl 2-[(2,6-dimethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-(2-methoxyacetyl)amino]propanoate. InChIKey: ZQEIXNIJLIKNTD-HEYPXIGASA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | methyl 2-[(2,6-dimethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-(2-methoxyacetyl)amino]propanoate |
| InChIKey | ZQEIXNIJLIKNTD-HEYPXIGASA-N |
| SMILES | C[13C]1=[13C]([13C](=[13CH][13CH]=[13CH]1)C)N(C(C)C(=O)OC)C(=O)COC |
Computed by PubChem (NCBI)