CAS 135631-02-6 is the registry number for Boc-L-Dab(Mal)-OH. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(2S)-4-(2,5-dioxopyrrol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 135631-02-6) is a chemical compound with the molecular formula C13H18N2O6 and a molecular weight of 298.29 g/mol. IUPAC name: (2S)-4-(2,5-dioxopyrrol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: UHJSKBYHYQNIKP-QMMMGPOBSA-N.
| Molecular formula | C13H18N2O6 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | (2S)-4-(2,5-dioxopyrrol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | UHJSKBYHYQNIKP-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCN1C(=O)C=CC1=O)C(=O)O |
Computed by PubChem (NCBI)