CAS 1356933-89-5 appears in our catalog under these names: Ergothioneine-d3, L-(+)-Ergothioneine-d3, >95% (HPLC). Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10 mg, 1 mg.
5-[(2S)-2-carboxy-2-[dimethyl(trideuteriomethyl)azaniumyl]ethyl]-1H-imidazole-2-thiolate (CAS 1356933-89-5) is a chemical compound with the molecular formula C9H15N3O2S and a molecular weight of 232.32 g/mol. IUPAC name: 5-[(2S)-2-carboxy-2-[dimethyl(trideuteriomethyl)azaniumyl]ethyl]-1H-imidazole-2-thiolate. InChIKey: SSISHJJTAXXQAX-LNEZGBMJSA-N.
| Molecular formula | C9H15N3O2S |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | 5-[(2S)-2-carboxy-2-[dimethyl(trideuteriomethyl)azaniumyl]ethyl]-1H-imidazole-2-thiolate |
| InChIKey | SSISHJJTAXXQAX-LNEZGBMJSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)[C@@H](CC1=CN=C(N1)[S-])C(=O)O |
Computed by PubChem (NCBI)