CAS 1356962-87-2 appears in our catalog under these names: 3-(5-Bromo-2-chloropyrimidin-4-yl)-1H-indole, 95%, 95%, 3-(5-Bromo-2-chloropyrimidin-4-yl)-1H-indole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-(5-bromo-2-chloropyrimidin-4-yl)-1H-indole (CAS 1356962-87-2) is a chemical compound with the molecular formula C12H7BrClN3 and a molecular weight of 308.56 g/mol. IUPAC name: 3-(5-bromo-2-chloropyrimidin-4-yl)-1H-indole. InChIKey: BGPOKROODJQYFN-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClN3 |
|---|---|
| Molecular weight | 308.56 g/mol |
| IUPAC name | 3-(5-bromo-2-chloropyrimidin-4-yl)-1H-indole |
| InChIKey | BGPOKROODJQYFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=NC(=NC=C3Br)Cl |
Computed by PubChem (NCBI)