CAS 19601-74-2 appears in our catalog under these names: 3-Bromo-6-chloro-2-phenylimidazo[1,2-b]pyridazine, 97%, 97%, 3-bromo-6-chloro-2-phenylimidazo[1,2-b]pyridazine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
3-bromo-6-chloro-2-phenylimidazo[1,2-b]pyridazine (CAS 19601-74-2) is a chemical compound with the molecular formula C12H7BrClN3 and a molecular weight of 308.56 g/mol. IUPAC name: 3-bromo-6-chloro-2-phenylimidazo[1,2-b]pyridazine. InChIKey: HCHKMKGRDUJJEU-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClN3 |
|---|---|
| Molecular weight | 308.56 g/mol |
| IUPAC name | 3-bromo-6-chloro-2-phenylimidazo[1,2-b]pyridazine |
| InChIKey | HCHKMKGRDUJJEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N3C(=N2)C=CC(=N3)Cl)Br |
Computed by PubChem (NCBI)