CAS 332419-69-9 is the registry number for 6-Bromo-2-(4-chlorophenyl)-1H-imidazo[4,5-b]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-(4-chlorophenyl)-1H-imidazo[4,5-b]pyridine (CAS 332419-69-9) is a chemical compound with the molecular formula C12H7BrClN3 and a molecular weight of 308.56 g/mol. IUPAC name: 6-bromo-2-(4-chlorophenyl)-1H-imidazo[4,5-b]pyridine. InChIKey: GGEBNEHQXNOXOW-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClN3 |
|---|---|
| Molecular weight | 308.56 g/mol |
| IUPAC name | 6-bromo-2-(4-chlorophenyl)-1H-imidazo[4,5-b]pyridine |
| InChIKey | GGEBNEHQXNOXOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=N3)Br)Cl |
Computed by PubChem (NCBI)