Products 1356997-25-5
CAS 1356997-25-5 is the registry number for 1-methyl-5-(4-(trifluoromethyl)phenyl)-1H-pyrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazole (CAS 1356997-25-5) is a chemical compound with the molecular formula C11H9F3N2 and a molecular weight of 226.20 g/mol. IUPAC name: 1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazole. InChIKey: QHWQDACNAMNMDH-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazole |
| InChIKey | QHWQDACNAMNMDH-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)