Products 135715-35-4
CAS 135715-35-4 is the registry number for 6-Benzyl-6-azabicyclo[3.2.1]octan-3-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-benzyl-6-azabicyclo[3.2.1]octan-3-one;hydrochloride (CAS 135715-35-4) is a chemical compound with the molecular formula C14H18ClNO and a molecular weight of 251.75 g/mol. IUPAC name: 6-benzyl-6-azabicyclo[3.2.1]octan-3-one;hydrochloride. InChIKey: AKYJRKLNUFDZKX-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | 6-benzyl-6-azabicyclo[3.2.1]octan-3-one;hydrochloride |
| InChIKey | AKYJRKLNUFDZKX-UHFFFAOYSA-N |
| SMILES | C1C2CC(=O)CC1N(C2)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)