CAS 1357308-53-2 appears in our catalog under these names: Fmoc-N-Me-beta-tBu-L-Ala-OH 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-4,4-dimethylpentanoic acid, 98%, 98%, Fmoc-N-Me-beta-tBu-Ala-OH, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4,4-dimethylpentanoic acid (CAS 1357308-53-2) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4,4-dimethylpentanoic acid. InChIKey: DHNYJKKISLDATB-FQEVSTJZSA-N.
| Molecular formula | C23H27NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4,4-dimethylpentanoic acid |
| InChIKey | DHNYJKKISLDATB-FQEVSTJZSA-N |
| SMILES | CC(C)(C)C[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)