CAS 1357350-92-5 is the registry number for S-(2,4-Dimethylphenyl)-DL-cysteine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.
2-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid (CAS 1357350-92-5) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 2-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid. InChIKey: QMZQFHPIZQSJSG-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2S |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 2-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid |
| InChIKey | QMZQFHPIZQSJSG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SCC(C(=O)O)N)C |
Computed by PubChem (NCBI)