Products 1357350-92-5

CAS 1357350-92-5 is the registry number for S-(2,4-Dimethylphenyl)-DL-cysteine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid (CAS 1357350-92-5) is a chemical compound with the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. IUPAC name: 2-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid. InChIKey: QMZQFHPIZQSJSG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO2S
Molecular weight225.31 g/mol
IUPAC name2-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid
InChIKeyQMZQFHPIZQSJSG-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)SCC(C(=O)O)N)C

Computed by PubChem (NCBI)