CAS 13574-81-7 appears in our catalog under these names: Cbz-Gly-Gly-ONp 97%, 4-Nitrophenyl 2-(2-(((benzyloxy)carbonyl)amino)acetamido)acetate, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-nitrophenyl) 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate (CAS 13574-81-7) is a chemical compound with the molecular formula C18H17N3O7 and a molecular weight of 387.3 g/mol. IUPAC name: (4-nitrophenyl) 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate. InChIKey: VJPZTTLCVFONEM-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O7 |
|---|---|
| Molecular weight | 387.3 g/mol |
| IUPAC name | (4-nitrophenyl) 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate |
| InChIKey | VJPZTTLCVFONEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC(=O)NCC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)