CAS 2682-04-4 is the registry number for 4-Nitrophenyl ((benzyloxy)carbonyl)-D-asparaginate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-nitrophenyl) (2R)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoate (CAS 2682-04-4) is a chemical compound with the molecular formula C18H17N3O7 and a molecular weight of 387.3 g/mol. IUPAC name: (4-nitrophenyl) (2R)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: YLWIFNIVONXXMG-OAHLLOKOSA-N.
| Molecular formula | C18H17N3O7 |
|---|---|
| Molecular weight | 387.3 g/mol |
| IUPAC name | (4-nitrophenyl) (2R)-4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | YLWIFNIVONXXMG-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC(=O)N)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)