CAS 3256-57-3 appears in our catalog under these names: Z-Asn-onp, 98%, Z–Asn–ONp. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g.
(4-nitrophenyl) 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoate (CAS 3256-57-3) is a chemical compound with the molecular formula C18H17N3O7 and a molecular weight of 387.3 g/mol. IUPAC name: (4-nitrophenyl) 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: YLWIFNIVONXXMG-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O7 |
|---|---|
| Molecular weight | 387.3 g/mol |
| IUPAC name | (4-nitrophenyl) 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | YLWIFNIVONXXMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC(=O)N)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)