CAS 13575-73-0 is the registry number for rac-(1R,2R)-2-Amino-2,3-dihydro-1H-inden-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-ol;hydrochloride (CAS 13575-73-0) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: (1R,2R)-2-amino-2,3-dihydro-1H-inden-1-ol;hydrochloride. InChIKey: KNFDUVWKQCDJQM-VTLYIQCISA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | (1R,2R)-2-amino-2,3-dihydro-1H-inden-1-ol;hydrochloride |
| InChIKey | KNFDUVWKQCDJQM-VTLYIQCISA-N |
| SMILES | C1[C@H]([C@@H](C2=CC=CC=C21)O)N.Cl |
Computed by PubChem (NCBI)