CAS 1357726-93-2 is the registry number for Lansoprazole Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dimethyl-5-nitro-1-oxidopyridin-1-ium (CAS 1357726-93-2) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2,3-dimethyl-5-nitro-1-oxidopyridin-1-ium. InChIKey: CEYKUZWVLXJXSO-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2,3-dimethyl-5-nitro-1-oxidopyridin-1-ium |
| InChIKey | CEYKUZWVLXJXSO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C[N+](=C1C)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)