CAS 135779-03-2 is the registry number for Methyl 3-formyl-2,4,6-trimethylbenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 3-formyl-2,4,6-trimethylbenzoate (CAS 135779-03-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: methyl 3-formyl-2,4,6-trimethylbenzoate. InChIKey: NPZKTVMOKQAXLY-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | methyl 3-formyl-2,4,6-trimethylbenzoate |
| InChIKey | NPZKTVMOKQAXLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C=O)C)C(=O)OC)C |
Computed by PubChem (NCBI)