Products 135779-03-2

CAS 135779-03-2 is the registry number for Methyl 3-formyl-2,4,6-trimethylbenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-formyl-2,4,6-trimethylbenzoate (CAS 135779-03-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: methyl 3-formyl-2,4,6-trimethylbenzoate. InChIKey: NPZKTVMOKQAXLY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O3
Molecular weight206.24 g/mol
IUPAC namemethyl 3-formyl-2,4,6-trimethylbenzoate
InChIKeyNPZKTVMOKQAXLY-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1C=O)C)C(=O)OC)C

Computed by PubChem (NCBI)