Products 135784-57-5
CAS 135784-57-5 appears in our catalog under these names: Dimetindene EP Impurity I Maleate, rac-N-Demethyl Dimetindene Maleate, N-Methyl-2-(3-((1RS)-1-(pyridin-2-yl)ethyl)-1H-inden-2-yl)ethanamine Maleate. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 5mg, 50mg.
(Z)-but-2-enedioic acid;N-methyl-2-[3-(1-pyridin-2-ylethyl)-1H-inden-2-yl]ethanamine (CAS 135784-57-5) is a chemical compound with the molecular formula C23H26N2O4 and a molecular weight of 394.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;N-methyl-2-[3-(1-pyridin-2-ylethyl)-1H-inden-2-yl]ethanamine. InChIKey: LTHOVYHNKXOGAI-BTJKTKAUSA-N.
| Molecular formula | C23H26N2O4 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;N-methyl-2-[3-(1-pyridin-2-ylethyl)-1H-inden-2-yl]ethanamine |
| InChIKey | LTHOVYHNKXOGAI-BTJKTKAUSA-N |
| SMILES | CC(C1=CC=CC=N1)C2=C(CC3=CC=CC=C32)CCNC.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)