Products 1452824-74-6
CAS 1452824-74-6 is the registry number for rac Milnacipran 2-Carboxylic Benzenecarboxamide. Offered by: TRC. Available pack sizes: 50mg.
2-[[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methylcarbamoyl]benzoic acid (CAS 1452824-74-6) is a chemical compound with the molecular formula C23H26N2O4 and a molecular weight of 394.5 g/mol. IUPAC name: 2-[[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methylcarbamoyl]benzoic acid. InChIKey: LVXMVNTXWRZTSK-GAJHUEQPSA-N.
| Molecular formula | C23H26N2O4 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | 2-[[(1R,2S)-2-(diethylcarbamoyl)-2-phenylcyclopropyl]methylcarbamoyl]benzoic acid |
| InChIKey | LVXMVNTXWRZTSK-GAJHUEQPSA-N |
| SMILES | CCN(CC)C(=O)[C@]1(C[C@H]1CNC(=O)C2=CC=CC=C2C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)