Products 222854-34-4

CAS 222854-34-4 is the registry number for 1-((9H-Fluoren-9-yl)methyl) 2-tert-butyl pyrazolidine-1,2-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-(9H-fluoren-9-ylmethyl) pyrazolidine-1,2-dicarboxylate (CAS 222854-34-4) is a chemical compound with the molecular formula C23H26N2O4 and a molecular weight of 394.5 g/mol. IUPAC name: 1-O-tert-butyl 2-O-(9H-fluoren-9-ylmethyl) pyrazolidine-1,2-dicarboxylate. InChIKey: PJFQIERERLIRHB-UHFFFAOYSA-N.

Identity
Molecular formulaC23H26N2O4
Molecular weight394.5 g/mol
IUPAC name1-O-tert-butyl 2-O-(9H-fluoren-9-ylmethyl) pyrazolidine-1,2-dicarboxylate
InChIKeyPJFQIERERLIRHB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)