CAS 1357942-94-9 is the registry number for N–(3,4,5–Trifluoro–2–nitrophenyl)acetamide. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
N-(3,4,5-trifluoro-2-nitrophenyl)acetamide (CAS 1357942-94-9) is a chemical compound with the molecular formula C8H5F3N2O3 and a molecular weight of 234.13 g/mol. IUPAC name: N-(3,4,5-trifluoro-2-nitrophenyl)acetamide. InChIKey: VJTQAKMQWIWCHN-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O3 |
|---|---|
| Molecular weight | 234.13 g/mol |
| IUPAC name | N-(3,4,5-trifluoro-2-nitrophenyl)acetamide |
| InChIKey | VJTQAKMQWIWCHN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C(=C1[N+](=O)[O-])F)F)F |
Computed by PubChem (NCBI)