CAS 388-11-4 is the registry number for 2-Acetamido-1-nitro-3,5,6-trifluorobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(3,4,6-trifluoro-2-nitrophenyl)acetamide (CAS 388-11-4) is a chemical compound with the molecular formula C8H5F3N2O3 and a molecular weight of 234.13 g/mol. IUPAC name: N-(3,4,6-trifluoro-2-nitrophenyl)acetamide. InChIKey: CAJSFXVPIMWHPO-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O3 |
|---|---|
| Molecular weight | 234.13 g/mol |
| IUPAC name | N-(3,4,6-trifluoro-2-nitrophenyl)acetamide |
| InChIKey | CAJSFXVPIMWHPO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=C(C=C1F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)