CAS 404-27-3 is the registry number for N-(P-Nitrophenyl)-2,2,2-trifluoroacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,2,2-trifluoro-N-(4-nitrophenyl)acetamide (CAS 404-27-3) is a chemical compound with the molecular formula C8H5F3N2O3 and a molecular weight of 234.13 g/mol. IUPAC name: 2,2,2-trifluoro-N-(4-nitrophenyl)acetamide. InChIKey: BLMWCZBKCOBVAM-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O3 |
|---|---|
| Molecular weight | 234.13 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-(4-nitrophenyl)acetamide |
| InChIKey | BLMWCZBKCOBVAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)