CAS 13580-85-3 is the registry number for 4-Chloro-n-methylphthalazin-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
4-chloro-N-methylphthalazin-1-amine (CAS 13580-85-3) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 4-chloro-N-methylphthalazin-1-amine. InChIKey: IVEYGGNOVQXDER-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 4-chloro-N-methylphthalazin-1-amine |
| InChIKey | IVEYGGNOVQXDER-UHFFFAOYSA-N |
| SMILES | CNC1=NN=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)