CAS 1358574-95-4 is the registry number for 4-Fluoro-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 1358574-95-4) is a chemical compound with the molecular formula C14H18BFN2O2 and a molecular weight of 276.12 g/mol. IUPAC name: 4-fluoro-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: BDLVZFGHUBZMDP-UHFFFAOYSA-N.
| Molecular formula | C14H18BFN2O2 |
|---|---|
| Molecular weight | 276.12 g/mol |
| IUPAC name | 4-fluoro-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | BDLVZFGHUBZMDP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=NN3C)C(=C2)F |
Computed by PubChem (NCBI)