Products 2821823-29-2
CAS 2821823-29-2 is the registry number for 6-Fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 2821823-29-2) is a chemical compound with the molecular formula C14H18BFN2O2 and a molecular weight of 276.12 g/mol. IUPAC name: 6-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: OMUPXJIHQRPUHD-UHFFFAOYSA-N.
| Molecular formula | C14H18BFN2O2 |
|---|---|
| Molecular weight | 276.12 g/mol |
| IUPAC name | 6-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | OMUPXJIHQRPUHD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=NNC3=CC(=C2C)F |
Computed by PubChem (NCBI)