CAS 2786863-92-9 is the registry number for 6-Fluoro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (CAS 2786863-92-9) is a chemical compound with the molecular formula C14H18BFN2O2 and a molecular weight of 276.12 g/mol. IUPAC name: 6-fluoro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole. InChIKey: QFJMEHBZGJCOGK-UHFFFAOYSA-N.
| Molecular formula | C14H18BFN2O2 |
|---|---|
| Molecular weight | 276.12 g/mol |
| IUPAC name | 6-fluoro-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| InChIKey | QFJMEHBZGJCOGK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC3=C2N(N=C3)C)F |
Computed by PubChem (NCBI)