Products 1359655-97-2

CAS 1359655-97-2 is the registry number for 1-(3-(4-Methoxyphenoxy)phenyl)guanidine nitrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[3-(4-methoxyphenoxy)phenyl]guanidine;nitric acid (CAS 1359655-97-2) is a chemical compound with the molecular formula C14H16N4O5 and a molecular weight of 320.30 g/mol. IUPAC name: 2-[3-(4-methoxyphenoxy)phenyl]guanidine;nitric acid. InChIKey: DELMSEZLIYUCSR-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16N4O5
Molecular weight320.30 g/mol
IUPAC name2-[3-(4-methoxyphenoxy)phenyl]guanidine;nitric acid
InChIKeyDELMSEZLIYUCSR-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)OC2=CC=CC(=C2)N=C(N)N.[N+](=O)(O)[O-]

Computed by PubChem (NCBI)