CAS 1359655-97-2 is the registry number for 1-(3-(4-Methoxyphenoxy)phenyl)guanidine nitrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[3-(4-methoxyphenoxy)phenyl]guanidine;nitric acid (CAS 1359655-97-2) is a chemical compound with the molecular formula C14H16N4O5 and a molecular weight of 320.30 g/mol. IUPAC name: 2-[3-(4-methoxyphenoxy)phenyl]guanidine;nitric acid. InChIKey: DELMSEZLIYUCSR-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O5 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | 2-[3-(4-methoxyphenoxy)phenyl]guanidine;nitric acid |
| InChIKey | DELMSEZLIYUCSR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=CC=CC(=C2)N=C(N)N.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)