Products 1808153-80-1
CAS 1808153-80-1 is the registry number for 4-(((Hexahydro-2,6-dioxo-4-pyrimidinyl)carbonyl)amino)-L-phenylalanine. Offered by: TRC. Available pack sizes: 50mg.
(2S)-2-amino-3-[4-[(2,6-dioxo-1,3-diazinane-4-carbonyl)amino]phenyl]propanoic acid (CAS 1808153-80-1) is a chemical compound with the molecular formula C14H16N4O5 and a molecular weight of 320.30 g/mol. IUPAC name: (2S)-2-amino-3-[4-[(2,6-dioxo-1,3-diazinane-4-carbonyl)amino]phenyl]propanoic acid. InChIKey: OLPMLGPIXOYZDU-RGURZIINSA-N.
| Molecular formula | C14H16N4O5 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-[(2,6-dioxo-1,3-diazinane-4-carbonyl)amino]phenyl]propanoic acid |
| InChIKey | OLPMLGPIXOYZDU-RGURZIINSA-N |
| SMILES | C1C(NC(=O)NC1=O)C(=O)NC2=CC=C(C=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)