CAS 99745-88-7 appears in our catalog under these names: Mitomycin Impurity 5, Mitomycin Impurity 6. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2S,3R)-2,6-diamino-3-hydroxy-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]methyl carbamate (CAS 99745-88-7) is a chemical compound with the molecular formula C14H16N4O5 and a molecular weight of 320.30 g/mol. IUPAC name: [(2S,3R)-2,6-diamino-3-hydroxy-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]methyl carbamate. InChIKey: XNHZZRIKMUCTHU-PWCHPLFNSA-N.
| Molecular formula | C14H16N4O5 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | [(2S,3R)-2,6-diamino-3-hydroxy-7-methyl-5,8-dioxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-4-yl]methyl carbamate |
| InChIKey | XNHZZRIKMUCTHU-PWCHPLFNSA-N |
| SMILES | CC1=C(C(=O)C2=C(C1=O)N3C[C@@H]([C@H](C3=C2COC(=O)N)O)N)N |
Computed by PubChem (NCBI)