Products 1359656-24-8
CAS 1359656-24-8 is the registry number for (4-(4-Chloro-3-(trifluoromethyl)phenoxy)phenyl)methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methanamine (CAS 1359656-24-8) is a chemical compound with the molecular formula C14H11ClF3NO and a molecular weight of 301.69 g/mol. IUPAC name: [4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methanamine. InChIKey: UQEVLCBMRCKHMM-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF3NO |
|---|---|
| Molecular weight | 301.69 g/mol |
| IUPAC name | [4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methanamine |
| InChIKey | UQEVLCBMRCKHMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)OC2=CC(=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)