Products 946741-39-5
CAS 946741-39-5 appears in our catalog under these names: 4-(4-Chloro-3-methylphenoxy)-2-(trifluoromethyl)aniline, 97%, 4-(4-Chloro-3-methylphenoxy)-2-(trifluoromethyl)-phenylamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-(4-chloro-3-methylphenoxy)-2-(trifluoromethyl)aniline (CAS 946741-39-5) is a chemical compound with the molecular formula C14H11ClF3NO and a molecular weight of 301.69 g/mol. IUPAC name: 4-(4-chloro-3-methylphenoxy)-2-(trifluoromethyl)aniline. InChIKey: OUZGDXDLIWDKBD-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF3NO |
|---|---|
| Molecular weight | 301.69 g/mol |
| IUPAC name | 4-(4-chloro-3-methylphenoxy)-2-(trifluoromethyl)aniline |
| InChIKey | OUZGDXDLIWDKBD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=CC(=C(C=C2)N)C(F)(F)F)Cl |
Computed by PubChem (NCBI)