Products 1715359-80-0
CAS 1715359-80-0 is the registry number for (4-Chlorophenyl)(4-(trifluoromethoxy)phenyl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-chlorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine (CAS 1715359-80-0) is a chemical compound with the molecular formula C14H11ClF3NO and a molecular weight of 301.69 g/mol. IUPAC name: (4-chlorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine. InChIKey: QDNNIPSRLCCODT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF3NO |
|---|---|
| Molecular weight | 301.69 g/mol |
| IUPAC name | (4-chlorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| InChIKey | QDNNIPSRLCCODT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)N)OC(F)(F)F |
Computed by PubChem (NCBI)