Products 1359745-86-0
CAS 1359745-86-0 is the registry number for N–(2–(2–Aminoethoxy)ethyl)–2,4–dinitroaniline. Offered by: GLPBio. Available pack sizes: 100mg, 250mg, 500mg.
N-[2-(2-aminoethoxy)ethyl]-2,4-dinitroaniline (CAS 1359745-86-0) is a chemical compound with the molecular formula C10H14N4O5 and a molecular weight of 270.24 g/mol. IUPAC name: N-[2-(2-aminoethoxy)ethyl]-2,4-dinitroaniline. InChIKey: SIIFPGYOPNAFLX-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | N-[2-(2-aminoethoxy)ethyl]-2,4-dinitroaniline |
| InChIKey | SIIFPGYOPNAFLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NCCOCCN |
Computed by PubChem (NCBI)