CAS 1359821-88-7 is the registry number for 4-(5-[(2S)-2-Pyrrolidinyl]-1,2,4-oxadiazol-3-yl)pyridine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-pyridin-4-yl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;dihydrochloride (CAS 1359821-88-7) is a chemical compound with the molecular formula C11H14Cl2N4O and a molecular weight of 289.16 g/mol. IUPAC name: 3-pyridin-4-yl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;dihydrochloride. InChIKey: FRLRQVMGYGXONE-WWPIYYJJSA-N.
| Molecular formula | C11H14Cl2N4O |
|---|---|
| Molecular weight | 289.16 g/mol |
| IUPAC name | 3-pyridin-4-yl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;dihydrochloride |
| InChIKey | FRLRQVMGYGXONE-WWPIYYJJSA-N |
| SMILES | C1C[C@H](NC1)C2=NC(=NO2)C3=CC=NC=C3.Cl.Cl |
Computed by PubChem (NCBI)