CAS 648409-46-5 is the registry number for Bis(5-chloro-1,3-dimethyl-1h-pyrazol-4-yl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Bis(5-chloro-1,3-dimethylpyrazol-4-yl)methanol (CAS 648409-46-5) is a chemical compound with the molecular formula C11H14Cl2N4O and a molecular weight of 289.16 g/mol. IUPAC name: bis(5-chloro-1,3-dimethylpyrazol-4-yl)methanol. InChIKey: KUUAAHLKMICVPK-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N4O |
|---|---|
| Molecular weight | 289.16 g/mol |
| IUPAC name | bis(5-chloro-1,3-dimethylpyrazol-4-yl)methanol |
| InChIKey | KUUAAHLKMICVPK-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C(C2=C(N(N=C2C)C)Cl)O)Cl)C |
Computed by PubChem (NCBI)