CAS 2060030-45-5 is the registry number for 2-(5-(3-Methylazetidin-3-yl)-1,3,4-oxadiazol-2-yl)pyridine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3-methylazetidin-3-yl)-5-pyridin-2-yl-1,3,4-oxadiazole;dihydrochloride (CAS 2060030-45-5) is a chemical compound with the molecular formula C11H14Cl2N4O and a molecular weight of 289.16 g/mol. IUPAC name: 2-(3-methylazetidin-3-yl)-5-pyridin-2-yl-1,3,4-oxadiazole;dihydrochloride. InChIKey: OXDKUBDIWDLVNR-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N4O |
|---|---|
| Molecular weight | 289.16 g/mol |
| IUPAC name | 2-(3-methylazetidin-3-yl)-5-pyridin-2-yl-1,3,4-oxadiazole;dihydrochloride |
| InChIKey | OXDKUBDIWDLVNR-UHFFFAOYSA-N |
| SMILES | CC1(CNC1)C2=NN=C(O2)C3=CC=CC=N3.Cl.Cl |
Computed by PubChem (NCBI)