CAS 136-64-1 appears in our catalog under these names: Terephthalic Dihydrazide, Terephthalic dihydrazide, 95% , Terephthalic Dihydrazide, >90.0%(HPLC), Terephthalic dihydrazide 90%, TEREPHTHALIC DIHYDRAZIDE, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 500g, 5g, 25g, 50g, 250g, 10g.
Benzene-1,4-dicarbohydrazide (CAS 136-64-1) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. IUPAC name: benzene-1,4-dicarbohydrazide. InChIKey: ALHNLFMSAXZKRC-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | benzene-1,4-dicarbohydrazide |
| InChIKey | ALHNLFMSAXZKRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NN)C(=O)NN |
Computed by PubChem (NCBI)