Products 1360442-43-8
CAS 1360442-43-8 appears in our catalog under these names: (R)-2-(3-Chlorophenyl)pyrrolidine hydrochloride, 95%, (R)–2–(3–Chlorophenyl)pyrrolidine hydrochloride, (R)-2-(3-Chlorophenyl)pyrrolidine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
(2R)-2-(3-chlorophenyl)pyrrolidine;hydrochloride (CAS 1360442-43-8) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: (2R)-2-(3-chlorophenyl)pyrrolidine;hydrochloride. InChIKey: SIAWSYYGMXRWLS-HNCPQSOCSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | (2R)-2-(3-chlorophenyl)pyrrolidine;hydrochloride |
| InChIKey | SIAWSYYGMXRWLS-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)