Products 2055841-65-9
CAS 2055841-65-9 appears in our catalog under these names: 6-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 6-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
6-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2055841-65-9) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: 6-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: AXGVCEPSKLJNQI-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | 6-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | AXGVCEPSKLJNQI-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)