Products 1209173-54-5
CAS 1209173-54-5 appears in our catalog under these names: (1-(3-Chlorophenyl)cyclopropyl)methanamine hydrochloride, 95%, (1-(3-Chlorophenyl)cyclopropyl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[1-(3-chlorophenyl)cyclopropyl]methanamine;hydrochloride (CAS 1209173-54-5) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: [1-(3-chlorophenyl)cyclopropyl]methanamine;hydrochloride. InChIKey: XWEXJYKHLQMCJW-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | [1-(3-chlorophenyl)cyclopropyl]methanamine;hydrochloride |
| InChIKey | XWEXJYKHLQMCJW-UHFFFAOYSA-N |
| SMILES | C1CC1(CN)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)