Products 136053-13-9

CAS 136053-13-9 is the registry number for N-Ethyl-2,4,6-trimethylpyridinium bromide. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 250mg.

Structural formula: {0} (CAS {1})

1-ethyl-2,4,6-trimethylpyridin-1-ium bromide (CAS 136053-13-9) is a chemical compound with the molecular formula C10H16BrN and a molecular weight of 230.14 g/mol. IUPAC name: 1-ethyl-2,4,6-trimethylpyridin-1-ium bromide. InChIKey: IXWREEXBACHUIP-UHFFFAOYSA-M.

Identity
Molecular formulaC10H16BrN
Molecular weight230.14 g/mol
IUPAC name1-ethyl-2,4,6-trimethylpyridin-1-ium bromide
InChIKeyIXWREEXBACHUIP-UHFFFAOYSA-M
SMILESCC[N+]1=C(C=C(C=C1C)C)C.[Br-]

Computed by PubChem (NCBI)