CAS 1446307-72-7 is the registry number for 4-(tert-Butyl)aniline hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-tert-butylaniline;hydrobromide (CAS 1446307-72-7) is a chemical compound with the molecular formula C10H16BrN and a molecular weight of 230.14 g/mol. IUPAC name: 4-tert-butylaniline;hydrobromide. InChIKey: QBYVXNFXSIBYES-UHFFFAOYSA-N.
| Molecular formula | C10H16BrN |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 4-tert-butylaniline;hydrobromide |
| InChIKey | QBYVXNFXSIBYES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N.Br |
Computed by PubChem (NCBI)