CAS 5350-41-4 appears in our catalog under these names: Terbutaline Impurity 39, N,N,N–Trimethyl–1–phenylmethanaminium bromide, Benzyltrimethylammonium bromide, 98+% , Benzyltrimethylammonium bromide, 98+%, Benzyltrimethylammonium Bromide, >98.0%(HPLC)(T). Offered by: Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI. Available pack sizes: on request, 250g, 500g, 25g, 100g, 1000g, 50g, 1kg.
Benzyl(trimethyl)azanium bromide (CAS 5350-41-4) is a chemical compound with the molecular formula C10H16BrN and a molecular weight of 230.14 g/mol. IUPAC name: benzyl(trimethyl)azanium bromide. InChIKey: UUZYBYIOAZTMGC-UHFFFAOYSA-M.
| Molecular formula | C10H16BrN |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | benzyl(trimethyl)azanium bromide |
| InChIKey | UUZYBYIOAZTMGC-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC1=CC=CC=C1.[Br-] |
Computed by PubChem (NCBI)