CAS 13608-55-4 appears in our catalog under these names: (3-Phenylisoxazol-5-yl)methylamine hydrochloride, 95%, (3-Phenylisoxazol-5-yl)methylamine hydrochloride, (3-Phenylisoxazol-5-yl)methylamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg.
(3-phenyl-1,2-oxazol-5-yl)methanamine;hydrochloride (CAS 13608-55-4) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: (3-phenyl-1,2-oxazol-5-yl)methanamine;hydrochloride. InChIKey: SBVZWCJQNGBAQG-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | (3-phenyl-1,2-oxazol-5-yl)methanamine;hydrochloride |
| InChIKey | SBVZWCJQNGBAQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2)CN.Cl |
Computed by PubChem (NCBI)