Products 1360869-92-6
CAS 1360869-92-6 is the registry number for DLC27-14. Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, Get quote.
3-[[2-[4-(4-tert-butylphenyl)phenoxy]acetyl]amino]benzoic acid (CAS 1360869-92-6) is a chemical compound with the molecular formula C25H25NO4 and a molecular weight of 403.5 g/mol. IUPAC name: 3-[[2-[4-(4-tert-butylphenyl)phenoxy]acetyl]amino]benzoic acid. InChIKey: QXBOQILKUMBONF-UHFFFAOYSA-N.
| Molecular formula | C25H25NO4 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | 3-[[2-[4-(4-tert-butylphenyl)phenoxy]acetyl]amino]benzoic acid |
| InChIKey | QXBOQILKUMBONF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)OCC(=O)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)