CAS 847849-67-6 appears in our catalog under these names: Defluoro Pitavastatin, Pitavastatin Desfluoro Impurity. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 500mg.
(E,3R,5S)-7-(2-cyclopropyl-4-phenylquinolin-3-yl)-3,5-dihydroxyhept-6-enoic acid (CAS 847849-67-6) is a chemical compound with the molecular formula C25H25NO4 and a molecular weight of 403.5 g/mol. IUPAC name: (E,3R,5S)-7-(2-cyclopropyl-4-phenylquinolin-3-yl)-3,5-dihydroxyhept-6-enoic acid. InChIKey: OPNBVERHJLFIFJ-WTWCKAPFSA-N.
| Molecular formula | C25H25NO4 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (E,3R,5S)-7-(2-cyclopropyl-4-phenylquinolin-3-yl)-3,5-dihydroxyhept-6-enoic acid |
| InChIKey | OPNBVERHJLFIFJ-WTWCKAPFSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=C2/C=C/[C@H](C[C@H](CC(=O)O)O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)