Products 55878-80-3
CAS 55878-80-3 appears in our catalog under these names: (S)–5–Methoxy–5–oxo–2–(tritylamino)pentanoic acid, (S)-5-Methoxy-5-oxo-2-(tritylamino)pentanoic acid, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(2S)-5-methoxy-5-oxo-2-(tritylamino)pentanoic acid (CAS 55878-80-3) is a chemical compound with the molecular formula C25H25NO4 and a molecular weight of 403.5 g/mol. IUPAC name: (2S)-5-methoxy-5-oxo-2-(tritylamino)pentanoic acid. InChIKey: LQSSSUAWROAMPP-QFIPXVFZSA-N.
| Molecular formula | C25H25NO4 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (2S)-5-methoxy-5-oxo-2-(tritylamino)pentanoic acid |
| InChIKey | LQSSSUAWROAMPP-QFIPXVFZSA-N |
| SMILES | COC(=O)CC[C@@H](C(=O)O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)