Products 1361115-91-4

CAS 1361115-91-4 is the registry number for 4-Methyl-piperidine-4-carboxylic acid methylamide hydrochloride. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

N,4-dimethylpiperidine-4-carboxamide;hydrochloride (CAS 1361115-91-4) is a chemical compound with the molecular formula C8H17ClN2O and a molecular weight of 192.68 g/mol. IUPAC name: N,4-dimethylpiperidine-4-carboxamide;hydrochloride. InChIKey: OWCMSMCNAMXXNK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClN2O
Molecular weight192.68 g/mol
IUPAC nameN,4-dimethylpiperidine-4-carboxamide;hydrochloride
InChIKeyOWCMSMCNAMXXNK-UHFFFAOYSA-N
SMILESCC1(CCNCC1)C(=O)NC.Cl

Computed by PubChem (NCBI)