CAS 1361118-66-2 appears in our catalog under these names: 4-(6-Chloro-2-methyl-pyrimidin-4-yl)-piperidine-1-carboxylic acid tert-butyl ester, 95%, tert-Butyl 4-(6-chloro-2-methylpyrimidin-4-yl)piperidine-1-carboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
Tert-butyl 4-(6-chloro-2-methylpyrimidin-4-yl)piperidine-1-carboxylate (CAS 1361118-66-2) is a chemical compound with the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. IUPAC name: tert-butyl 4-(6-chloro-2-methylpyrimidin-4-yl)piperidine-1-carboxylate. InChIKey: WHNSUCDCHCPAPB-UHFFFAOYSA-N.
| Molecular formula | C15H22ClN3O2 |
|---|---|
| Molecular weight | 311.81 g/mol |
| IUPAC name | tert-butyl 4-(6-chloro-2-methylpyrimidin-4-yl)piperidine-1-carboxylate |
| InChIKey | WHNSUCDCHCPAPB-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)Cl)C2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)