Products 1386950-73-7
CAS 1386950-73-7 is the registry number for tert-Butyl 4-(4-amino-3-chlorophenyl)piperazine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 4-(4-amino-3-chlorophenyl)piperazine-1-carboxylate (CAS 1386950-73-7) is a chemical compound with the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. IUPAC name: tert-butyl 4-(4-amino-3-chlorophenyl)piperazine-1-carboxylate. InChIKey: DAHHGOLPHPTCFF-UHFFFAOYSA-N.
| Molecular formula | C15H22ClN3O2 |
|---|---|
| Molecular weight | 311.81 g/mol |
| IUPAC name | tert-butyl 4-(4-amino-3-chlorophenyl)piperazine-1-carboxylate |
| InChIKey | DAHHGOLPHPTCFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=C(C=C2)N)Cl |
Computed by PubChem (NCBI)